C22H18ClN3O — CID 42876507
6-(3-chlorophenyl)-N-(2-phenylethyl)imidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 42876507) has the molecular formula C22H18ClN3O and a molecular weight of 375.86 g/mol. Its IUPAC name is 6-(3-chlorophenyl)-N-(2-phenylethyl)imidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | 6-(3-chlorophenyl)-N-(2-phenylethyl)imidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 42876507 |
| Molecular Formula | C22H18ClN3O |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 6-(3-chlorophenyl)-N-(2-phenylethyl)imidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | O=C(NCCc1ccccc1)c1cn2cc(-c3cccc(Cl)c3)ccc2n1 |
| InChI | InChI=1S/C22H18ClN3O/c23-19-8-4-7-17(13-19)18-9-10-21-25-20(15-26(21)14-18)22(27)24-12-11-16-5-2-1-3-6-16/h1-10,13-15H,11-12H2,(H,24,27) |
| InChIKey | PXEFCGGPQKZQGO-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |