C21H29N5O3S — CID 42876951
N-(3-methoxypropyl)-2-[4-[2-(3-methylanilino)-1,3-thiazole-4-carbonyl]piperazin-1-yl]acetamide (PubChem CID 42876951) has the molecular formula C21H29N5O3S and a molecular weight of 431.56 g/mol. Its IUPAC name is N-(3-methoxypropyl)-2-[4-[2-(3-methylanilino)-1,3-thiazole-4-carbonyl]piperazin-1-yl]acetamide.
| Compound Name | N-(3-methoxypropyl)-2-[4-[2-(3-methylanilino)-1,3-thiazole-4-carbonyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 42876951 |
| Molecular Formula | C21H29N5O3S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | N-(3-methoxypropyl)-2-[4-[2-(3-methylanilino)-1,3-thiazole-4-carbonyl]piperazin-1-yl]acetamide |
| SMILES | COCCCNC(=O)CN1CCN(C(=O)c2csc(Nc3cccc(C)c3)n2)CC1 |
| InChI | InChI=1S/C21H29N5O3S/c1-16-5-3-6-17(13-16)23-21-24-18(15-30-21)20(28)26-10-8-25(9-11-26)14-19(27)22-7-4-12-29-2/h3,5-6,13,15H,4,7-12,14H2,1-2H3,(H,22,27)(H,23,24) |
| InChIKey | SGSXCBRCBOFSKN-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|