C25H29N5O4S — CID 46079084
2-[4-[2-(4-methoxyanilino)-1,3-thiazole-4-carbonyl]piperazin-1-yl]-N-(2-phenoxyethyl)acetamide (PubChem CID 46079084) has the molecular formula C25H29N5O4S and a molecular weight of 495.61 g/mol. Its IUPAC name is 2-[4-[2-(4-methoxyanilino)-1,3-thiazole-4-carbonyl]piperazin-1-yl]-N-(2-phenoxyethyl)acetamide.
| Compound Name | 2-[4-[2-(4-methoxyanilino)-1,3-thiazole-4-carbonyl]piperazin-1-yl]-N-(2-phenoxyethyl)acetamide |
|---|---|
| PubChem CID | 46079084 |
| Molecular Formula | C25H29N5O4S |
| Molecular Weight | 495.61 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | 2-[4-[2-(4-methoxyanilino)-1,3-thiazole-4-carbonyl]piperazin-1-yl]-N-(2-phenoxyethyl)acetamide |
| SMILES | COc1ccc(Nc2nc(C(=O)N3CCN(CC(=O)NCCOc4ccccc4)CC3)cs2)cc1 |
| InChI | InChI=1S/C25H29N5O4S/c1-33-20-9-7-19(8-10-20)27-25-28-22(18-35-25)24(32)30-14-12-29(13-15-30)17-23(31)26-11-16-34-21-5-3-2-4-6-21/h2-10,18H,11-17H2,1H3,(H,26,31)(H,27,28) |
| InChIKey | POFQZUZMXHEKRP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.61 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|