C28H30N6O3 — CID 42877466
[2-tert-butyl-5-(4-methylphenyl)pyrazolo[1,5-a]pyrimidin-7-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone (PubChem CID 42877466) has the molecular formula C28H30N6O3 and a molecular weight of 498.59 g/mol. Its IUPAC name is [2-tert-butyl-5-(4-methylphenyl)pyrazolo[1,5-a]pyrimidin-7-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone.
| Compound Name | [2-tert-butyl-5-(4-methylphenyl)pyrazolo[1,5-a]pyrimidin-7-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 42877466 |
| Molecular Formula | C28H30N6O3 |
| Molecular Weight | 498.59 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | [2-tert-butyl-5-(4-methylphenyl)pyrazolo[1,5-a]pyrimidin-7-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
| SMILES | Cc1ccc(-c2cc(C(=O)N3CCN(c4ccc([N+](=O)[O-])cc4)CC3)n3nc(C(C)(C)C)cc3n2)cc1 |
| InChI | InChI=1S/C28H30N6O3/c1-19-5-7-20(8-6-19)23-17-24(33-26(29-23)18-25(30-33)28(2,3)4)27(35)32-15-13-31(14-16-32)21-9-11-22(12-10-21)34(36)37/h5-12,17-18H,13-16H2,1-4H3 |
| InChIKey | FKQWFPYPPQKODB-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 96.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.59 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|