C29H24N6O3 — CID 46079190
(2,5-diphenylpyrazolo[1,5-a]pyrimidin-7-yl)-[4-(4-nitrophenyl)piperazin-1-yl]methanone (PubChem CID 46079190) has the molecular formula C29H24N6O3 and a molecular weight of 504.55 g/mol. Its IUPAC name is (2,5-diphenylpyrazolo[1,5-a]pyrimidin-7-yl)-[4-(4-nitrophenyl)piperazin-1-yl]methanone.
| Compound Name | (2,5-diphenylpyrazolo[1,5-a]pyrimidin-7-yl)-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 46079190 |
| Molecular Formula | C29H24N6O3 |
| Molecular Weight | 504.55 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | (2,5-diphenylpyrazolo[1,5-a]pyrimidin-7-yl)-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cc(-c2ccccc2)nc2cc(-c3ccccc3)nn12)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C29H24N6O3/c36-29(33-17-15-32(16-18-33)23-11-13-24(14-12-23)35(37)38)27-19-25(21-7-3-1-4-8-21)30-28-20-26(31-34(27)28)22-9-5-2-6-10-22/h1-14,19-20H,15-18H2 |
| InChIKey | MFEBNAKBNCLWPH-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 96.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.55 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|