C26H32FN3O3 — CID 42878019
N-[3-(dimethylamino)propyl]-2-[1-[(3-fluorophenyl)methyl]-2-oxo-4-propan-2-ylquinolin-7-yl]oxyacetamide (PubChem CID 42878019) has the molecular formula C26H32FN3O3 and a molecular weight of 453.56 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-2-[1-[(3-fluorophenyl)methyl]-2-oxo-4-propan-2-ylquinolin-7-yl]oxyacetamide.
| Compound Name | N-[3-(dimethylamino)propyl]-2-[1-[(3-fluorophenyl)methyl]-2-oxo-4-propan-2-ylquinolin-7-yl]oxyacetamide |
|---|---|
| PubChem CID | 42878019 |
| Molecular Formula | C26H32FN3O3 |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-2-[1-[(3-fluorophenyl)methyl]-2-oxo-4-propan-2-ylquinolin-7-yl]oxyacetamide |
| SMILES | CC(C)c1cc(=O)n(Cc2cccc(F)c2)c2cc(OCC(=O)NCCCN(C)C)ccc12 |
| InChI | InChI=1S/C26H32FN3O3/c1-18(2)23-15-26(32)30(16-19-7-5-8-20(27)13-19)24-14-21(9-10-22(23)24)33-17-25(31)28-11-6-12-29(3)4/h5,7-10,13-15,18H,6,11-12,16-17H2,1-4H3,(H,28,31) |
| InChIKey | XBVPTJLNVKZYGV-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|