C28H39N5O2 — CID 42878180
4-[[[3-ethyl-5-(4-ethylpiperazin-1-yl)-1-phenylpyrazol-4-yl]methyl-propylamino]methyl]benzene-1,2-diol (PubChem CID 42878180) has the molecular formula C28H39N5O2 and a molecular weight of 477.65 g/mol. Its IUPAC name is 4-[[[3-ethyl-5-(4-ethylpiperazin-1-yl)-1-phenylpyrazol-4-yl]methyl-propylamino]methyl]benzene-1,2-diol.
| Compound Name | 4-[[[3-ethyl-5-(4-ethylpiperazin-1-yl)-1-phenylpyrazol-4-yl]methyl-propylamino]methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 42878180 |
| Molecular Formula | C28H39N5O2 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.31 |
| IUPAC Name | 4-[[[3-ethyl-5-(4-ethylpiperazin-1-yl)-1-phenylpyrazol-4-yl]methyl-propylamino]methyl]benzene-1,2-diol |
| SMILES | CCCN(Cc1ccc(O)c(O)c1)Cc1c(CC)nn(-c2ccccc2)c1N1CCN(CC)CC1 |
| InChI | InChI=1S/C28H39N5O2/c1-4-14-31(20-22-12-13-26(34)27(35)19-22)21-24-25(5-2)29-33(23-10-8-7-9-11-23)28(24)32-17-15-30(6-3)16-18-32/h7-13,19,34-35H,4-6,14-18,20-21H2,1-3H3 |
| InChIKey | POLDKPGWSQJNNT-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 68.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|