C20H30FN5 — CID 42876351
N-[[3-ethyl-5-(4-ethylpiperazin-1-yl)-1-(4-fluorophenyl)pyrazol-4-yl]methyl]ethanamine (PubChem CID 42876351) has the molecular formula C20H30FN5 and a molecular weight of 359.49 g/mol. Its IUPAC name is N-[[3-ethyl-5-(4-ethylpiperazin-1-yl)-1-(4-fluorophenyl)pyrazol-4-yl]methyl]ethanamine.
| Compound Name | N-[[3-ethyl-5-(4-ethylpiperazin-1-yl)-1-(4-fluorophenyl)pyrazol-4-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 42876351 |
| Molecular Formula | C20H30FN5 |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | N-[[3-ethyl-5-(4-ethylpiperazin-1-yl)-1-(4-fluorophenyl)pyrazol-4-yl]methyl]ethanamine |
| SMILES | CCNCc1c(CC)nn(-c2ccc(F)cc2)c1N1CCN(CC)CC1 |
| InChI | InChI=1S/C20H30FN5/c1-4-19-18(15-22-5-2)20(25-13-11-24(6-3)12-14-25)26(23-19)17-9-7-16(21)8-10-17/h7-10,22H,4-6,11-15H2,1-3H3 |
| InChIKey | IWNLJMRJBNVZMQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |