C20H30FN5O — CID 42689954
N-[[3-ethyl-1-(4-fluorophenyl)-5-(4-methylpiperazin-1-yl)pyrazol-4-yl]methyl]-2-methoxyethanamine (PubChem CID 42689954) has the molecular formula C20H30FN5O and a molecular weight of 375.49 g/mol. Its IUPAC name is N-[[3-ethyl-1-(4-fluorophenyl)-5-(4-methylpiperazin-1-yl)pyrazol-4-yl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[3-ethyl-1-(4-fluorophenyl)-5-(4-methylpiperazin-1-yl)pyrazol-4-yl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 42689954 |
| Molecular Formula | C20H30FN5O |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | N-[[3-ethyl-1-(4-fluorophenyl)-5-(4-methylpiperazin-1-yl)pyrazol-4-yl]methyl]-2-methoxyethanamine |
| SMILES | CCc1nn(-c2ccc(F)cc2)c(N2CCN(C)CC2)c1CNCCOC |
| InChI | InChI=1S/C20H30FN5O/c1-4-19-18(15-22-9-14-27-3)20(25-12-10-24(2)11-13-25)26(23-19)17-7-5-16(21)6-8-17/h5-8,22H,4,9-15H2,1-3H3 |
| InChIKey | GNHWYMUXLGWBRG-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 45.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|