C27H43FN6O — CID 46080784
3-butyl-1-[[3-ethyl-1-(4-fluorophenyl)-5-(4-propan-2-ylpiperazin-1-yl)pyrazol-4-yl]methyl]-1-propylurea (PubChem CID 46080784) has the molecular formula C27H43FN6O and a molecular weight of 486.68 g/mol. Its IUPAC name is 3-butyl-1-[[3-ethyl-1-(4-fluorophenyl)-5-(4-propan-2-ylpiperazin-1-yl)pyrazol-4-yl]methyl]-1-propylurea.
| Compound Name | 3-butyl-1-[[3-ethyl-1-(4-fluorophenyl)-5-(4-propan-2-ylpiperazin-1-yl)pyrazol-4-yl]methyl]-1-propylurea |
|---|---|
| PubChem CID | 46080784 |
| Molecular Formula | C27H43FN6O |
| Molecular Weight | 486.68 g/mol |
| Exact Mass | 486.35 |
| IUPAC Name | 3-butyl-1-[[3-ethyl-1-(4-fluorophenyl)-5-(4-propan-2-ylpiperazin-1-yl)pyrazol-4-yl]methyl]-1-propylurea |
| SMILES | CCCCNC(=O)N(CCC)Cc1c(CC)nn(-c2ccc(F)cc2)c1N1CCN(C(C)C)CC1 |
| InChI | InChI=1S/C27H43FN6O/c1-6-9-14-29-27(35)33(15-7-2)20-24-25(8-3)30-34(23-12-10-22(28)11-13-23)26(24)32-18-16-31(17-19-32)21(4)5/h10-13,21H,6-9,14-20H2,1-5H3,(H,29,35) |
| InChIKey | MVPINKZIIDBYDV-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 56.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.68 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|