C22H24F6N4O2 — CID 42878657
6-[3,5-bis(trifluoromethyl)phenyl]-N-(2-morpholin-4-ylethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 42878657) has the molecular formula C22H24F6N4O2 and a molecular weight of 490.45 g/mol. Its IUPAC name is 6-[3,5-bis(trifluoromethyl)phenyl]-N-(2-morpholin-4-ylethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | 6-[3,5-bis(trifluoromethyl)phenyl]-N-(2-morpholin-4-ylethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 42878657 |
| Molecular Formula | C22H24F6N4O2 |
| Molecular Weight | 490.45 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | 6-[3,5-bis(trifluoromethyl)phenyl]-N-(2-morpholin-4-ylethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | O=C(NCCN1CCOCC1)c1cn2c(n1)CCC(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C2 |
| InChI | InChI=1S/C22H24F6N4O2/c23-21(24,25)16-9-15(10-17(11-16)22(26,27)28)14-1-2-19-30-18(13-32(19)12-14)20(33)29-3-4-31-5-7-34-8-6-31/h9-11,13-14H,1-8,12H2,(H,29,33) |
| InChIKey | AFZICQXHJCXJPZ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |