C20H22F6N4O — CID 93013368
(6S)-6-[3,5-bis(trifluoromethyl)phenyl]-N-[2-(dimethylamino)ethyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 93013368) has the molecular formula C20H22F6N4O and a molecular weight of 448.41 g/mol. Its IUPAC name is (6S)-6-[3,5-bis(trifluoromethyl)phenyl]-N-[2-(dimethylamino)ethyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | (6S)-6-[3,5-bis(trifluoromethyl)phenyl]-N-[2-(dimethylamino)ethyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 93013368 |
| Molecular Formula | C20H22F6N4O |
| Molecular Weight | 448.41 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | (6S)-6-[3,5-bis(trifluoromethyl)phenyl]-N-[2-(dimethylamino)ethyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | CN(C)CCNC(=O)c1cn2c(n1)CC[C@@H](c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C2 |
| InChI | InChI=1S/C20H22F6N4O/c1-29(2)6-5-27-18(31)16-11-30-10-12(3-4-17(30)28-16)13-7-14(19(21,22)23)9-15(8-13)20(24,25)26/h7-9,11-12H,3-6,10H2,1-2H3,(H,27,31)/t12-/m1/s1 |
| InChIKey | ZECFVOOULZGYMM-GFCCVEGCSA-N |
| XLogP | 3.94 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.41 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |