C20H21F6N3O — CID 93013332
(6R)-6-[3,5-bis(trifluoromethyl)phenyl]-N-[(2R)-butan-2-yl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 93013332) has the molecular formula C20H21F6N3O and a molecular weight of 433.40 g/mol. Its IUPAC name is (6R)-6-[3,5-bis(trifluoromethyl)phenyl]-N-[(2R)-butan-2-yl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | (6R)-6-[3,5-bis(trifluoromethyl)phenyl]-N-[(2R)-butan-2-yl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 93013332 |
| Molecular Formula | C20H21F6N3O |
| Molecular Weight | 433.40 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | (6R)-6-[3,5-bis(trifluoromethyl)phenyl]-N-[(2R)-butan-2-yl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | CC[C@@H](C)NC(=O)c1cn2c(n1)CC[C@H](c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C2 |
| InChI | InChI=1S/C20H21F6N3O/c1-3-11(2)27-18(30)16-10-29-9-12(4-5-17(29)28-16)13-6-14(19(21,22)23)8-15(7-13)20(24,25)26/h6-8,10-12H,3-5,9H2,1-2H3,(H,27,30)/t11-,12+/m1/s1 |
| InChIKey | DQWUGPQYKYJXCD-NEPJUHHUSA-N |
| XLogP | 5.18 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.40 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |