C26H23F7N4O — CID 98408994
[(6R)-6-[3,5-bis(trifluoromethyl)phenyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl]-[4-(2-fluorophenyl)piperazin-1-yl]methanone (PubChem CID 98408994) has the molecular formula C26H23F7N4O and a molecular weight of 540.48 g/mol. Its IUPAC name is [(6R)-6-[3,5-bis(trifluoromethyl)phenyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl]-[4-(2-fluorophenyl)piperazin-1-yl]methanone.
| Compound Name | [(6R)-6-[3,5-bis(trifluoromethyl)phenyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl]-[4-(2-fluorophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 98408994 |
| Molecular Formula | C26H23F7N4O |
| Molecular Weight | 540.48 g/mol |
| Exact Mass | 540.18 |
| IUPAC Name | [(6R)-6-[3,5-bis(trifluoromethyl)phenyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl]-[4-(2-fluorophenyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cn2c(n1)CC[C@H](c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C2)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C26H23F7N4O/c27-20-3-1-2-4-22(20)35-7-9-36(10-8-35)24(38)21-15-37-14-16(5-6-23(37)34-21)17-11-18(25(28,29)30)13-19(12-17)26(31,32)33/h1-4,11-13,15-16H,5-10,14H2/t16-/m0/s1 |
| InChIKey | FKFSGNFLPPSIEN-INIZCTEOSA-N |
| XLogP | 5.75 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.48 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |