C28H26FN3O — CID 93012968
(6S)-N-[(1R)-1,2-diphenylethyl]-6-(4-fluorophenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 93012968) has the molecular formula C28H26FN3O and a molecular weight of 439.53 g/mol. Its IUPAC name is (6S)-N-[(1R)-1,2-diphenylethyl]-6-(4-fluorophenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | (6S)-N-[(1R)-1,2-diphenylethyl]-6-(4-fluorophenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 93012968 |
| Molecular Formula | C28H26FN3O |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | (6S)-N-[(1R)-1,2-diphenylethyl]-6-(4-fluorophenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | O=C(N[C@H](Cc1ccccc1)c1ccccc1)c1cn2c(n1)CC[C@@H](c1ccc(F)cc1)C2 |
| InChI | InChI=1S/C28H26FN3O/c29-24-14-11-21(12-15-24)23-13-16-27-30-26(19-32(27)18-23)28(33)31-25(22-9-5-2-6-10-22)17-20-7-3-1-4-8-20/h1-12,14-15,19,23,25H,13,16-18H2,(H,31,33)/t23-,25-/m1/s1 |
| InChIKey | OCWRMHKCFZQGLR-ILBGXUMGSA-N |
| XLogP | 5.47 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |