C29H29N3O2 — CID 46081011
N-(1,2-diphenylethyl)-6-(3-methoxyphenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 46081011) has the molecular formula C29H29N3O2 and a molecular weight of 451.57 g/mol. Its IUPAC name is N-(1,2-diphenylethyl)-6-(3-methoxyphenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | N-(1,2-diphenylethyl)-6-(3-methoxyphenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 46081011 |
| Molecular Formula | C29H29N3O2 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | N-(1,2-diphenylethyl)-6-(3-methoxyphenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | COc1cccc(C2CCc3nc(C(=O)NC(Cc4ccccc4)c4ccccc4)cn3C2)c1 |
| InChI | InChI=1S/C29H29N3O2/c1-34-25-14-8-13-23(18-25)24-15-16-28-30-27(20-32(28)19-24)29(33)31-26(22-11-6-3-7-12-22)17-21-9-4-2-5-10-21/h2-14,18,20,24,26H,15-17,19H2,1H3,(H,31,33) |
| InChIKey | WCPRDWMFROPPSN-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |