C24H29N3O — CID 42879111
N-benzyl-5-(4-tert-butylphenyl)-1-ethyl-N-methylpyrazole-3-carboxamide (PubChem CID 42879111) has the molecular formula C24H29N3O and a molecular weight of 375.52 g/mol. Its IUPAC name is N-benzyl-5-(4-tert-butylphenyl)-1-ethyl-N-methylpyrazole-3-carboxamide.
| Compound Name | N-benzyl-5-(4-tert-butylphenyl)-1-ethyl-N-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 42879111 |
| Molecular Formula | C24H29N3O |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | N-benzyl-5-(4-tert-butylphenyl)-1-ethyl-N-methylpyrazole-3-carboxamide |
| SMILES | CCn1nc(C(=O)N(C)Cc2ccccc2)cc1-c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C24H29N3O/c1-6-27-22(19-12-14-20(15-13-19)24(2,3)4)16-21(25-27)23(28)26(5)17-18-10-8-7-9-11-18/h7-16H,6,17H2,1-5H3 |
| InChIKey | NJRVRCRSCRMEBD-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |