C25H23FN4O — CID 57467732
N-benzyl-1-ethyl-3-(4-fluorophenyl)-N-methyl-4-pyridin-4-ylpyrazole-5-carboxamide (PubChem CID 57467732) has the molecular formula C25H23FN4O and a molecular weight of 414.48 g/mol. Its IUPAC name is N-benzyl-1-ethyl-3-(4-fluorophenyl)-N-methyl-4-pyridin-4-ylpyrazole-5-carboxamide.
| Compound Name | N-benzyl-1-ethyl-3-(4-fluorophenyl)-N-methyl-4-pyridin-4-ylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 57467732 |
| Molecular Formula | C25H23FN4O |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | N-benzyl-1-ethyl-3-(4-fluorophenyl)-N-methyl-4-pyridin-4-ylpyrazole-5-carboxamide |
| SMILES | CCn1nc(-c2ccc(F)cc2)c(-c2ccncc2)c1C(=O)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C25H23FN4O/c1-3-30-24(25(31)29(2)17-18-7-5-4-6-8-18)22(19-13-15-27-16-14-19)23(28-30)20-9-11-21(26)12-10-20/h4-16H,3,17H2,1-2H3 |
| InChIKey | ZMJVBKCPPMXHGY-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |