C23H42N4O3 — CID 42881460
N-(3-morpholin-4-ylpropyl)-1-(1-pentanoylpiperidin-4-yl)piperidine-4-carboxamide (PubChem CID 42881460) has the molecular formula C23H42N4O3 and a molecular weight of 422.61 g/mol. Its IUPAC name is N-(3-morpholin-4-ylpropyl)-1-(1-pentanoylpiperidin-4-yl)piperidine-4-carboxamide.
| Compound Name | N-(3-morpholin-4-ylpropyl)-1-(1-pentanoylpiperidin-4-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 42881460 |
| Molecular Formula | C23H42N4O3 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.33 |
| IUPAC Name | N-(3-morpholin-4-ylpropyl)-1-(1-pentanoylpiperidin-4-yl)piperidine-4-carboxamide |
| SMILES | CCCCC(=O)N1CCC(N2CCC(C(=O)NCCCN3CCOCC3)CC2)CC1 |
| InChI | InChI=1S/C23H42N4O3/c1-2-3-5-22(28)27-14-8-21(9-15-27)26-12-6-20(7-13-26)23(29)24-10-4-11-25-16-18-30-19-17-25/h20-21H,2-19H2,1H3,(H,24,29) |
| InChIKey | WCRSSJRKAZTPGD-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|