C27H43N3O2 — CID 42881485
1-[1-(4-tert-butylbenzoyl)piperidin-4-yl]-N-(3-methylbutyl)piperidine-4-carboxamide (PubChem CID 42881485) has the molecular formula C27H43N3O2 and a molecular weight of 441.66 g/mol. Its IUPAC name is 1-[1-(4-tert-butylbenzoyl)piperidin-4-yl]-N-(3-methylbutyl)piperidine-4-carboxamide.
| Compound Name | 1-[1-(4-tert-butylbenzoyl)piperidin-4-yl]-N-(3-methylbutyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 42881485 |
| Molecular Formula | C27H43N3O2 |
| Molecular Weight | 441.66 g/mol |
| Exact Mass | 441.34 |
| IUPAC Name | 1-[1-(4-tert-butylbenzoyl)piperidin-4-yl]-N-(3-methylbutyl)piperidine-4-carboxamide |
| SMILES | CC(C)CCNC(=O)C1CCN(C2CCN(C(=O)c3ccc(C(C)(C)C)cc3)CC2)CC1 |
| InChI | InChI=1S/C27H43N3O2/c1-20(2)10-15-28-25(31)21-11-16-29(17-12-21)24-13-18-30(19-14-24)26(32)22-6-8-23(9-7-22)27(3,4)5/h6-9,20-21,24H,10-19H2,1-5H3,(H,28,31) |
| InChIKey | AXQBGIWPLQXVQN-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.66 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |