C22H39N3O2 — CID 42881490
1-[1-(cyclopentanecarbonyl)piperidin-4-yl]-N-(3-methylbutyl)piperidine-4-carboxamide (PubChem CID 42881490) has the molecular formula C22H39N3O2 and a molecular weight of 377.57 g/mol. Its IUPAC name is 1-[1-(cyclopentanecarbonyl)piperidin-4-yl]-N-(3-methylbutyl)piperidine-4-carboxamide.
| Compound Name | 1-[1-(cyclopentanecarbonyl)piperidin-4-yl]-N-(3-methylbutyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 42881490 |
| Molecular Formula | C22H39N3O2 |
| Molecular Weight | 377.57 g/mol |
| Exact Mass | 377.30 |
| IUPAC Name | 1-[1-(cyclopentanecarbonyl)piperidin-4-yl]-N-(3-methylbutyl)piperidine-4-carboxamide |
| SMILES | CC(C)CCNC(=O)C1CCN(C2CCN(C(=O)C3CCCC3)CC2)CC1 |
| InChI | InChI=1S/C22H39N3O2/c1-17(2)7-12-23-21(26)18-8-13-24(14-9-18)20-10-15-25(16-11-20)22(27)19-5-3-4-6-19/h17-20H,3-16H2,1-2H3,(H,23,26) |
| InChIKey | WWYRFYVSGOUHDR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.57 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |