C26H41N3O3 — CID 42881514
1-[1-(2-ethylhexanoyl)piperidin-4-yl]-N-(3-methoxyphenyl)piperidine-4-carboxamide (PubChem CID 42881514) has the molecular formula C26H41N3O3 and a molecular weight of 443.63 g/mol. Its IUPAC name is 1-[1-(2-ethylhexanoyl)piperidin-4-yl]-N-(3-methoxyphenyl)piperidine-4-carboxamide.
| Compound Name | 1-[1-(2-ethylhexanoyl)piperidin-4-yl]-N-(3-methoxyphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 42881514 |
| Molecular Formula | C26H41N3O3 |
| Molecular Weight | 443.63 g/mol |
| Exact Mass | 443.31 |
| IUPAC Name | 1-[1-(2-ethylhexanoyl)piperidin-4-yl]-N-(3-methoxyphenyl)piperidine-4-carboxamide |
| SMILES | CCCCC(CC)C(=O)N1CCC(N2CCC(C(=O)Nc3cccc(OC)c3)CC2)CC1 |
| InChI | InChI=1S/C26H41N3O3/c1-4-6-8-20(5-2)26(31)29-17-13-23(14-18-29)28-15-11-21(12-16-28)25(30)27-22-9-7-10-24(19-22)32-3/h7,9-10,19-21,23H,4-6,8,11-18H2,1-3H3,(H,27,30) |
| InChIKey | CGRCMBNGRSKDOK-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.63 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |