C17H20ClN3O3 — CID 42883929
2-[[5-(4-chlorophenyl)furan-2-yl]methyl-methylamino]-N-(methylcarbamoyl)propanamide (PubChem CID 42883929) has the molecular formula C17H20ClN3O3 and a molecular weight of 349.82 g/mol. Its IUPAC name is 2-[[5-(4-chlorophenyl)furan-2-yl]methyl-methylamino]-N-(methylcarbamoyl)propanamide.
| Compound Name | 2-[[5-(4-chlorophenyl)furan-2-yl]methyl-methylamino]-N-(methylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 42883929 |
| Molecular Formula | C17H20ClN3O3 |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 2-[[5-(4-chlorophenyl)furan-2-yl]methyl-methylamino]-N-(methylcarbamoyl)propanamide |
| SMILES | CNC(=O)NC(=O)C(C)N(C)Cc1ccc(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C17H20ClN3O3/c1-11(16(22)20-17(23)19-2)21(3)10-14-8-9-15(24-14)12-4-6-13(18)7-5-12/h4-9,11H,10H2,1-3H3,(H2,19,20,22,23) |
| InChIKey | IGLJXZGDDNGQGP-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |