C16H19ClN3O3+ — CID 8720910
[5-(4-chlorophenyl)furan-2-yl]methyl-methyl-[2-(methylcarbamoylamino)-2-oxoethyl]azanium (PubChem CID 8720910) has the molecular formula C16H19ClN3O3+ and a molecular weight of 336.80 g/mol. Its IUPAC name is [5-(4-chlorophenyl)furan-2-yl]methyl-methyl-[2-(methylcarbamoylamino)-2-oxoethyl]azanium.
| Compound Name | [5-(4-chlorophenyl)furan-2-yl]methyl-methyl-[2-(methylcarbamoylamino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8720910 |
| Molecular Formula | C16H19ClN3O3+ |
| Molecular Weight | 336.80 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | [5-(4-chlorophenyl)furan-2-yl]methyl-methyl-[2-(methylcarbamoylamino)-2-oxoethyl]azanium |
| SMILES | CNC(=O)NC(=O)C[NH+](C)Cc1ccc(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C16H18ClN3O3/c1-18-16(22)19-15(21)10-20(2)9-13-7-8-14(23-13)11-3-5-12(17)6-4-11/h3-8H,9-10H2,1-2H3,(H2,18,19,21,22)/p+1 |
| InChIKey | DXNUZUMWSCFEED-UHFFFAOYSA-O |
| XLogP | 1.07 |
| TPSA | 75.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.80 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |