C12H17N3OS — CID 42885261
3-(3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-ylsulfanylmethyl)-5-methyl-1,2-oxazole (PubChem CID 42885261) has the molecular formula C12H17N3OS and a molecular weight of 251.35 g/mol. Its IUPAC name is 3-(3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-ylsulfanylmethyl)-5-methyl-1,2-oxazole.
| Compound Name | 3-(3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-ylsulfanylmethyl)-5-methyl-1,2-oxazole |
|---|---|
| PubChem CID | 42885261 |
| Molecular Formula | C12H17N3OS |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 3-(3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-ylsulfanylmethyl)-5-methyl-1,2-oxazole |
| SMILES | Cc1cc(CSC2=NC3CCCCC3N2)no1 |
| InChI | InChI=1S/C12H17N3OS/c1-8-6-9(15-16-8)7-17-12-13-10-4-2-3-5-11(10)14-12/h6,10-11H,2-5,7H2,1H3,(H,13,14) |
| InChIKey | SUZDZZHRMAVYDS-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |