C21H20F2N4O4 — CID 42887204
2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)propanamide (PubChem CID 42887204) has the molecular formula C21H20F2N4O4 and a molecular weight of 430.41 g/mol. Its IUPAC name is 2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)propanamide.
| Compound Name | 2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)propanamide |
|---|---|
| PubChem CID | 42887204 |
| Molecular Formula | C21H20F2N4O4 |
| Molecular Weight | 430.41 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)propanamide |
| SMILES | Cc1c(NC(=O)C(C)Nc2ccc3c(c2)OC(F)(F)O3)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C21H20F2N4O4/c1-12(24-14-9-10-16-17(11-14)31-21(22,23)30-16)19(28)25-18-13(2)26(3)27(20(18)29)15-7-5-4-6-8-15/h4-12,24H,1-3H3,(H,25,28) |
| InChIKey | PSWWXMOEUFLGSN-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.41 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|