C22H22N2O3S — CID 42890950
N-[4-oxo-4-(4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)butyl]furan-2-carboxamide (PubChem CID 42890950) has the molecular formula C22H22N2O3S and a molecular weight of 394.50 g/mol. Its IUPAC name is N-[4-oxo-4-(4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)butyl]furan-2-carboxamide.
| Compound Name | N-[4-oxo-4-(4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)butyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 42890950 |
| Molecular Formula | C22H22N2O3S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | N-[4-oxo-4-(4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)butyl]furan-2-carboxamide |
| SMILES | O=C(NCCCC(=O)N1CCc2sccc2C1c1ccccc1)c1ccco1 |
| InChI | InChI=1S/C22H22N2O3S/c25-20(9-4-12-23-22(26)18-8-5-14-27-18)24-13-10-19-17(11-15-28-19)21(24)16-6-2-1-3-7-16/h1-3,5-8,11,14-15,21H,4,9-10,12-13H2,(H,23,26) |
| InChIKey | ZSTULUMLGOMKME-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|