C19H29N3O3S — CID 42891319
2-[2-(azepan-1-yl)anilino]-N-(1,1-dioxothiolan-3-yl)-N-methylacetamide (PubChem CID 42891319) has the molecular formula C19H29N3O3S and a molecular weight of 379.53 g/mol. Its IUPAC name is 2-[2-(azepan-1-yl)anilino]-N-(1,1-dioxothiolan-3-yl)-N-methylacetamide.
| Compound Name | 2-[2-(azepan-1-yl)anilino]-N-(1,1-dioxothiolan-3-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 42891319 |
| Molecular Formula | C19H29N3O3S |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 2-[2-(azepan-1-yl)anilino]-N-(1,1-dioxothiolan-3-yl)-N-methylacetamide |
| SMILES | CN(C(=O)CNc1ccccc1N1CCCCCC1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H29N3O3S/c1-21(16-10-13-26(24,25)15-16)19(23)14-20-17-8-4-5-9-18(17)22-11-6-2-3-7-12-22/h4-5,8-9,16,20H,2-3,6-7,10-15H2,1H3 |
| InChIKey | MFOLXLKSNRLQRM-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |