C27H36N6OS — CID 42892417
N-[3-(N-methylanilino)propyl]-2-[[4-phenyl-5-(1-piperidin-1-ylethyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 42892417) has the molecular formula C27H36N6OS and a molecular weight of 492.69 g/mol. Its IUPAC name is N-[3-(N-methylanilino)propyl]-2-[[4-phenyl-5-(1-piperidin-1-ylethyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-[3-(N-methylanilino)propyl]-2-[[4-phenyl-5-(1-piperidin-1-ylethyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 42892417 |
| Molecular Formula | C27H36N6OS |
| Molecular Weight | 492.69 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | N-[3-(N-methylanilino)propyl]-2-[[4-phenyl-5-(1-piperidin-1-ylethyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CC(c1nnc(SCC(=O)NCCCN(C)c2ccccc2)n1-c1ccccc1)N1CCCCC1 |
| InChI | InChI=1S/C27H36N6OS/c1-22(32-19-10-5-11-20-32)26-29-30-27(33(26)24-15-8-4-9-16-24)35-21-25(34)28-17-12-18-31(2)23-13-6-3-7-14-23/h3-4,6-9,13-16,22H,5,10-12,17-21H2,1-2H3,(H,28,34) |
| InChIKey | ZZHFDXYECXVSAW-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.69 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|