C21H21N3O2S2 — CID 42894575
2-(4-methylphenyl)sulfonyl-2-[3-(2-methylpropylsulfanyl)quinoxalin-2-yl]acetonitrile (PubChem CID 42894575) has the molecular formula C21H21N3O2S2 and a molecular weight of 411.55 g/mol. Its IUPAC name is 2-(4-methylphenyl)sulfonyl-2-[3-(2-methylpropylsulfanyl)quinoxalin-2-yl]acetonitrile.
| Compound Name | 2-(4-methylphenyl)sulfonyl-2-[3-(2-methylpropylsulfanyl)quinoxalin-2-yl]acetonitrile |
|---|---|
| PubChem CID | 42894575 |
| Molecular Formula | C21H21N3O2S2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | 2-(4-methylphenyl)sulfonyl-2-[3-(2-methylpropylsulfanyl)quinoxalin-2-yl]acetonitrile |
| SMILES | Cc1ccc(S(=O)(=O)C(C#N)c2nc3ccccc3nc2SCC(C)C)cc1 |
| InChI | InChI=1S/C21H21N3O2S2/c1-14(2)13-27-21-20(23-17-6-4-5-7-18(17)24-21)19(12-22)28(25,26)16-10-8-15(3)9-11-16/h4-11,14,19H,13H2,1-3H3 |
| InChIKey | DDFZLADEHKUEFM-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 83.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |