C23H23N3O2S2 — CID 42958397
2-(3-cyclohexylsulfanylquinoxalin-2-yl)-2-(4-methylphenyl)sulfonylacetonitrile (PubChem CID 42958397) has the molecular formula C23H23N3O2S2 and a molecular weight of 437.59 g/mol. Its IUPAC name is 2-(3-cyclohexylsulfanylquinoxalin-2-yl)-2-(4-methylphenyl)sulfonylacetonitrile.
| Compound Name | 2-(3-cyclohexylsulfanylquinoxalin-2-yl)-2-(4-methylphenyl)sulfonylacetonitrile |
|---|---|
| PubChem CID | 42958397 |
| Molecular Formula | C23H23N3O2S2 |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | 2-(3-cyclohexylsulfanylquinoxalin-2-yl)-2-(4-methylphenyl)sulfonylacetonitrile |
| SMILES | Cc1ccc(S(=O)(=O)C(C#N)c2nc3ccccc3nc2SC2CCCCC2)cc1 |
| InChI | InChI=1S/C23H23N3O2S2/c1-16-11-13-18(14-12-16)30(27,28)21(15-24)22-23(29-17-7-3-2-4-8-17)26-20-10-6-5-9-19(20)25-22/h5-6,9-14,17,21H,2-4,7-8H2,1H3 |
| InChIKey | FJKVPUGGJCDBFY-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 83.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |