C23H23N5O3S — CID 2101695
N-[4-[(S)-cyano-[3-(cyclopentylamino)quinoxalin-2-yl]methyl]sulfonylphenyl]acetamide (PubChem CID 2101695) has the molecular formula C23H23N5O3S and a molecular weight of 449.54 g/mol. Its IUPAC name is N-[4-[(S)-cyano-[3-(cyclopentylamino)quinoxalin-2-yl]methyl]sulfonylphenyl]acetamide.
| Compound Name | N-[4-[(S)-cyano-[3-(cyclopentylamino)quinoxalin-2-yl]methyl]sulfonylphenyl]acetamide |
|---|---|
| PubChem CID | 2101695 |
| Molecular Formula | C23H23N5O3S |
| Molecular Weight | 449.54 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | N-[4-[(S)-cyano-[3-(cyclopentylamino)quinoxalin-2-yl]methyl]sulfonylphenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)[C@H](C#N)c2nc3ccccc3nc2NC2CCCC2)cc1 |
| InChI | InChI=1S/C23H23N5O3S/c1-15(29)25-17-10-12-18(13-11-17)32(30,31)21(14-24)22-23(26-16-6-2-3-7-16)28-20-9-5-4-8-19(20)27-22/h4-5,8-13,16,21H,2-3,6-7H2,1H3,(H,25,29)(H,26,28)/t21-/m1/s1 |
| InChIKey | IPAVKGOGHHBRHQ-OAQYLSRUSA-N |
| XLogP | 3.98 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.54 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |