C26H23N5O3S — CID 2161095
N-[4-[(R)-cyano-[3-(2-phenylethylamino)quinoxalin-2-yl]methyl]sulfonylphenyl]acetamide (PubChem CID 2161095) has the molecular formula C26H23N5O3S and a molecular weight of 485.57 g/mol. Its IUPAC name is N-[4-[(R)-cyano-[3-(2-phenylethylamino)quinoxalin-2-yl]methyl]sulfonylphenyl]acetamide.
| Compound Name | N-[4-[(R)-cyano-[3-(2-phenylethylamino)quinoxalin-2-yl]methyl]sulfonylphenyl]acetamide |
|---|---|
| PubChem CID | 2161095 |
| Molecular Formula | C26H23N5O3S |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | N-[4-[(R)-cyano-[3-(2-phenylethylamino)quinoxalin-2-yl]methyl]sulfonylphenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)[C@@H](C#N)c2nc3ccccc3nc2NCCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H23N5O3S/c1-18(32)29-20-11-13-21(14-12-20)35(33,34)24(17-27)25-26(28-16-15-19-7-3-2-4-8-19)31-23-10-6-5-9-22(23)30-25/h2-14,24H,15-16H2,1H3,(H,28,31)(H,29,32)/t24-/m0/s1 |
| InChIKey | ARVLCEOHIVJQSD-DEOSSOPVSA-N |
| XLogP | 4.28 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |