C19H20ClNO4S — CID 42896247
2-(2-chloro-4-phenylphenoxy)-N-(3-methyl-1,1-dioxothiolan-3-yl)acetamide (PubChem CID 42896247) has the molecular formula C19H20ClNO4S and a molecular weight of 393.89 g/mol. Its IUPAC name is 2-(2-chloro-4-phenylphenoxy)-N-(3-methyl-1,1-dioxothiolan-3-yl)acetamide.
| Compound Name | 2-(2-chloro-4-phenylphenoxy)-N-(3-methyl-1,1-dioxothiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 42896247 |
| Molecular Formula | C19H20ClNO4S |
| Molecular Weight | 393.89 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | 2-(2-chloro-4-phenylphenoxy)-N-(3-methyl-1,1-dioxothiolan-3-yl)acetamide |
| SMILES | CC1(NC(=O)COc2ccc(-c3ccccc3)cc2Cl)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H20ClNO4S/c1-19(9-10-26(23,24)13-19)21-18(22)12-25-17-8-7-15(11-16(17)20)14-5-3-2-4-6-14/h2-8,11H,9-10,12-13H2,1H3,(H,21,22) |
| InChIKey | HNTDXGXFJJSJPY-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.89 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |