C14H16BrNO5S — CID 7819853
2-(4-bromo-2-formylphenoxy)-N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]acetamide (PubChem CID 7819853) has the molecular formula C14H16BrNO5S and a molecular weight of 390.26 g/mol. Its IUPAC name is 2-(4-bromo-2-formylphenoxy)-N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]acetamide.
| Compound Name | 2-(4-bromo-2-formylphenoxy)-N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]acetamide |
|---|---|
| PubChem CID | 7819853 |
| Molecular Formula | C14H16BrNO5S |
| Molecular Weight | 390.26 g/mol |
| Exact Mass | 388.99 |
| IUPAC Name | 2-(4-bromo-2-formylphenoxy)-N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]acetamide |
| SMILES | C[C@]1(NC(=O)COc2ccc(Br)cc2C=O)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H16BrNO5S/c1-14(4-5-22(19,20)9-14)16-13(18)8-21-12-3-2-11(15)6-10(12)7-17/h2-3,6-7H,4-5,8-9H2,1H3,(H,16,18)/t14-/m0/s1 |
| InChIKey | HZDFYHMWWXSRGI-AWEZNQCLSA-N |
| XLogP | 1.33 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.26 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|