C23H27FN2O6S — CID 42896915
methyl 2-[4-[1-(3-fluoro-4-methoxyphenyl)ethylcarbamoyl]piperidin-1-yl]sulfonylbenzoate (PubChem CID 42896915) has the molecular formula C23H27FN2O6S and a molecular weight of 478.54 g/mol. Its IUPAC name is methyl 2-[4-[1-(3-fluoro-4-methoxyphenyl)ethylcarbamoyl]piperidin-1-yl]sulfonylbenzoate.
| Compound Name | methyl 2-[4-[1-(3-fluoro-4-methoxyphenyl)ethylcarbamoyl]piperidin-1-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 42896915 |
| Molecular Formula | C23H27FN2O6S |
| Molecular Weight | 478.54 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | methyl 2-[4-[1-(3-fluoro-4-methoxyphenyl)ethylcarbamoyl]piperidin-1-yl]sulfonylbenzoate |
| SMILES | COC(=O)c1ccccc1S(=O)(=O)N1CCC(C(=O)NC(C)c2ccc(OC)c(F)c2)CC1 |
| InChI | InChI=1S/C23H27FN2O6S/c1-15(17-8-9-20(31-2)19(24)14-17)25-22(27)16-10-12-26(13-11-16)33(29,30)21-7-5-4-6-18(21)23(28)32-3/h4-9,14-16H,10-13H2,1-3H3,(H,25,27) |
| InChIKey | PFWDHNYPIXINAD-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.54 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |