C20H20N2O2S — CID 4290009
1-[1-benzothiophen-2-yl(pyridin-3-yl)methyl]piperidine-2-carboxylic acid (PubChem CID 4290009) has the molecular formula C20H20N2O2S and a molecular weight of 352.46 g/mol. Its IUPAC name is 1-[1-benzothiophen-2-yl(pyridin-3-yl)methyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[1-benzothiophen-2-yl(pyridin-3-yl)methyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 4290009 |
| Molecular Formula | C20H20N2O2S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 1-[1-benzothiophen-2-yl(pyridin-3-yl)methyl]piperidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCCN1C(c1cccnc1)c1cc2ccccc2s1 |
| InChI | InChI=1S/C20H20N2O2S/c23-20(24)16-8-3-4-11-22(16)19(15-7-5-10-21-13-15)18-12-14-6-1-2-9-17(14)25-18/h1-2,5-7,9-10,12-13,16,19H,3-4,8,11H2,(H,23,24) |
| InChIKey | BSHICPCKCKNIPV-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |