C15H18N4O5S — CID 42906269
2-[2-[2-(2-methylfuran-3-carbonyl)hydrazinyl]-2-oxoethyl]sulfanyl-N-(5-methyl-1,2-oxazol-3-yl)propanamide (PubChem CID 42906269) has the molecular formula C15H18N4O5S and a molecular weight of 366.40 g/mol. Its IUPAC name is 2-[2-[2-(2-methylfuran-3-carbonyl)hydrazinyl]-2-oxoethyl]sulfanyl-N-(5-methyl-1,2-oxazol-3-yl)propanamide.
| Compound Name | 2-[2-[2-(2-methylfuran-3-carbonyl)hydrazinyl]-2-oxoethyl]sulfanyl-N-(5-methyl-1,2-oxazol-3-yl)propanamide |
|---|---|
| PubChem CID | 42906269 |
| Molecular Formula | C15H18N4O5S |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 2-[2-[2-(2-methylfuran-3-carbonyl)hydrazinyl]-2-oxoethyl]sulfanyl-N-(5-methyl-1,2-oxazol-3-yl)propanamide |
| SMILES | Cc1cc(NC(=O)C(C)SCC(=O)NNC(=O)c2ccoc2C)no1 |
| InChI | InChI=1S/C15H18N4O5S/c1-8-6-12(19-24-8)16-14(21)10(3)25-7-13(20)17-18-15(22)11-4-5-23-9(11)2/h4-6,10H,7H2,1-3H3,(H,17,20)(H,18,22)(H,16,19,21) |
| InChIKey | HOGJLFRIEOXQRO-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 126.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|