C19H24N4O5S — CID 9472073
(2S)-2-[2-[2-[2-(4-ethylphenoxy)acetyl]hydrazinyl]-2-oxoethyl]sulfanyl-N-(5-methyl-1,2-oxazol-3-yl)propanamide (PubChem CID 9472073) has the molecular formula C19H24N4O5S and a molecular weight of 420.49 g/mol. Its IUPAC name is (2S)-2-[2-[2-[2-(4-ethylphenoxy)acetyl]hydrazinyl]-2-oxoethyl]sulfanyl-N-(5-methyl-1,2-oxazol-3-yl)propanamide.
| Compound Name | (2S)-2-[2-[2-[2-(4-ethylphenoxy)acetyl]hydrazinyl]-2-oxoethyl]sulfanyl-N-(5-methyl-1,2-oxazol-3-yl)propanamide |
|---|---|
| PubChem CID | 9472073 |
| Molecular Formula | C19H24N4O5S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | (2S)-2-[2-[2-[2-(4-ethylphenoxy)acetyl]hydrazinyl]-2-oxoethyl]sulfanyl-N-(5-methyl-1,2-oxazol-3-yl)propanamide |
| SMILES | CCc1ccc(OCC(=O)NNC(=O)CS[C@@H](C)C(=O)Nc2cc(C)on2)cc1 |
| InChI | InChI=1S/C19H24N4O5S/c1-4-14-5-7-15(8-6-14)27-10-17(24)21-22-18(25)11-29-13(3)19(26)20-16-9-12(2)28-23-16/h5-9,13H,4,10-11H2,1-3H3,(H,21,24)(H,22,25)(H,20,23,26)/t13-/m0/s1 |
| InChIKey | YTCIXLGIXNXSQJ-ZDUSSCGKSA-N |
| XLogP | 1.83 |
| TPSA | 122.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|