C25H30N2O4S — CID 42906533
(E)-N-[4-[1-(2-bicyclo[2.2.1]heptanyl)ethylsulfamoyl]phenyl]-3-(2-methoxyphenyl)prop-2-enamide (PubChem CID 42906533) has the molecular formula C25H30N2O4S and a molecular weight of 454.59 g/mol. Its IUPAC name is (E)-N-[4-[1-(2-bicyclo[2.2.1]heptanyl)ethylsulfamoyl]phenyl]-3-(2-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-[1-(2-bicyclo[2.2.1]heptanyl)ethylsulfamoyl]phenyl]-3-(2-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 42906533 |
| Molecular Formula | C25H30N2O4S |
| Molecular Weight | 454.59 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | (E)-N-[4-[1-(2-bicyclo[2.2.1]heptanyl)ethylsulfamoyl]phenyl]-3-(2-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccccc1/C=C/C(=O)Nc1ccc(S(=O)(=O)NC(C)C2CC3CCC2C3)cc1 |
| InChI | InChI=1S/C25H30N2O4S/c1-17(23-16-18-7-8-20(23)15-18)27-32(29,30)22-12-10-21(11-13-22)26-25(28)14-9-19-5-3-4-6-24(19)31-2/h3-6,9-14,17-18,20,23,27H,7-8,15-16H2,1-2H3,(H,26,28)/b14-9+ |
| InChIKey | IZPKLWOLXUNOKO-NTEUORMPSA-N |
| XLogP | 4.45 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.59 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|