C22H28N2O5 — CID 42906840
2-(4-acetyl-2-methoxyphenoxy)-N-[2-(dimethylamino)-2-(2-methoxyphenyl)ethyl]acetamide (PubChem CID 42906840) has the molecular formula C22H28N2O5 and a molecular weight of 400.48 g/mol. Its IUPAC name is 2-(4-acetyl-2-methoxyphenoxy)-N-[2-(dimethylamino)-2-(2-methoxyphenyl)ethyl]acetamide.
| Compound Name | 2-(4-acetyl-2-methoxyphenoxy)-N-[2-(dimethylamino)-2-(2-methoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 42906840 |
| Molecular Formula | C22H28N2O5 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 2-(4-acetyl-2-methoxyphenoxy)-N-[2-(dimethylamino)-2-(2-methoxyphenyl)ethyl]acetamide |
| SMILES | COc1cc(C(C)=O)ccc1OCC(=O)NCC(c1ccccc1OC)N(C)C |
| InChI | InChI=1S/C22H28N2O5/c1-15(25)16-10-11-20(21(12-16)28-5)29-14-22(26)23-13-18(24(2)3)17-8-6-7-9-19(17)27-4/h6-12,18H,13-14H2,1-5H3,(H,23,26) |
| InChIKey | DJEJNZQJWWULSZ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |