C21H28N2O4 — CID 43006220
N-[2-(dimethylamino)-2-(2-methoxyphenyl)ethyl]-2-(2-methoxy-4-methylphenoxy)acetamide (PubChem CID 43006220) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-(2-methoxyphenyl)ethyl]-2-(2-methoxy-4-methylphenoxy)acetamide.
| Compound Name | N-[2-(dimethylamino)-2-(2-methoxyphenyl)ethyl]-2-(2-methoxy-4-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 43006220 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | N-[2-(dimethylamino)-2-(2-methoxyphenyl)ethyl]-2-(2-methoxy-4-methylphenoxy)acetamide |
| SMILES | COc1cc(C)ccc1OCC(=O)NCC(c1ccccc1OC)N(C)C |
| InChI | InChI=1S/C21H28N2O4/c1-15-10-11-19(20(12-15)26-5)27-14-21(24)22-13-17(23(2)3)16-8-6-7-9-18(16)25-4/h6-12,17H,13-14H2,1-5H3,(H,22,24) |
| InChIKey | WGCDBALVSQHGEM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |