C23H22F2N2O4S — CID 42907074
N-[1-(2,4-difluorophenyl)ethyl]-3-[(4-methoxyphenyl)-methylsulfamoyl]benzamide (PubChem CID 42907074) has the molecular formula C23H22F2N2O4S and a molecular weight of 460.50 g/mol. Its IUPAC name is N-[1-(2,4-difluorophenyl)ethyl]-3-[(4-methoxyphenyl)-methylsulfamoyl]benzamide.
| Compound Name | N-[1-(2,4-difluorophenyl)ethyl]-3-[(4-methoxyphenyl)-methylsulfamoyl]benzamide |
|---|---|
| PubChem CID | 42907074 |
| Molecular Formula | C23H22F2N2O4S |
| Molecular Weight | 460.50 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | N-[1-(2,4-difluorophenyl)ethyl]-3-[(4-methoxyphenyl)-methylsulfamoyl]benzamide |
| SMILES | COc1ccc(N(C)S(=O)(=O)c2cccc(C(=O)NC(C)c3ccc(F)cc3F)c2)cc1 |
| InChI | InChI=1S/C23H22F2N2O4S/c1-15(21-12-7-17(24)14-22(21)25)26-23(28)16-5-4-6-20(13-16)32(29,30)27(2)18-8-10-19(31-3)11-9-18/h4-15H,1-3H3,(H,26,28) |
| InChIKey | CUEYUZWLNIXGKE-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.50 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |