C20H20N4O6S2 — CID 42907329
N-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-yl]-1-(1,1-dioxothiolan-3-yl)-6-oxo-4,5-dihydropyridazine-3-carboxamide (PubChem CID 42907329) has the molecular formula C20H20N4O6S2 and a molecular weight of 476.54 g/mol. Its IUPAC name is N-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-yl]-1-(1,1-dioxothiolan-3-yl)-6-oxo-4,5-dihydropyridazine-3-carboxamide.
| Compound Name | N-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-yl]-1-(1,1-dioxothiolan-3-yl)-6-oxo-4,5-dihydropyridazine-3-carboxamide |
|---|---|
| PubChem CID | 42907329 |
| Molecular Formula | C20H20N4O6S2 |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.08 |
| IUPAC Name | N-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-yl]-1-(1,1-dioxothiolan-3-yl)-6-oxo-4,5-dihydropyridazine-3-carboxamide |
| SMILES | O=C(Nc1nc(-c2ccc3c(c2)OCCO3)cs1)C1=NN(C2CCS(=O)(=O)C2)C(=O)CC1 |
| InChI | InChI=1S/C20H20N4O6S2/c25-18-4-2-14(23-24(18)13-5-8-32(27,28)11-13)19(26)22-20-21-15(10-31-20)12-1-3-16-17(9-12)30-7-6-29-16/h1,3,9-10,13H,2,4-8,11H2,(H,21,22,26) |
| InChIKey | GYVXRTNIHKGDBZ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 127.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |