C23H22N2O4 — CID 42908533
1-(furan-2-ylmethyl)-N-[2-(4-methylphenoxy)phenyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 42908533) has the molecular formula C23H22N2O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-N-[2-(4-methylphenoxy)phenyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(furan-2-ylmethyl)-N-[2-(4-methylphenoxy)phenyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 42908533 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 1-(furan-2-ylmethyl)-N-[2-(4-methylphenoxy)phenyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | Cc1ccc(Oc2ccccc2NC(=O)C2CC(=O)N(Cc3ccco3)C2)cc1 |
| InChI | InChI=1S/C23H22N2O4/c1-16-8-10-18(11-9-16)29-21-7-3-2-6-20(21)24-23(27)17-13-22(26)25(14-17)15-19-5-4-12-28-19/h2-12,17H,13-15H2,1H3,(H,24,27) |
| InChIKey | XIKRCAHVGNHSBR-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |