C25H27N3O6S — CID 42908994
3-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-[5-[(2-methoxyphenyl)sulfamoyl]-2-methylphenyl]propanamide (PubChem CID 42908994) has the molecular formula C25H27N3O6S and a molecular weight of 497.57 g/mol. Its IUPAC name is 3-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-[5-[(2-methoxyphenyl)sulfamoyl]-2-methylphenyl]propanamide.
| Compound Name | 3-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-[5-[(2-methoxyphenyl)sulfamoyl]-2-methylphenyl]propanamide |
|---|---|
| PubChem CID | 42908994 |
| Molecular Formula | C25H27N3O6S |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | 3-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-[5-[(2-methoxyphenyl)sulfamoyl]-2-methylphenyl]propanamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1ccc(C)c(NC(=O)CCN2C(=O)C3CC=CCC3C2=O)c1 |
| InChI | InChI=1S/C25H27N3O6S/c1-16-11-12-17(35(32,33)27-20-9-5-6-10-22(20)34-2)15-21(16)26-23(29)13-14-28-24(30)18-7-3-4-8-19(18)25(28)31/h3-6,9-12,15,18-19,27H,7-8,13-14H2,1-2H3,(H,26,29) |
| InChIKey | QTRKMMZTWXYTMG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|