C18H26N4S — CID 42909717
2,7-dimethyl-4-(4-methyl-1,4-diazepan-1-yl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine (PubChem CID 42909717) has the molecular formula C18H26N4S and a molecular weight of 330.50 g/mol. Its IUPAC name is 2,7-dimethyl-4-(4-methyl-1,4-diazepan-1-yl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine.
| Compound Name | 2,7-dimethyl-4-(4-methyl-1,4-diazepan-1-yl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 42909717 |
| Molecular Formula | C18H26N4S |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 2,7-dimethyl-4-(4-methyl-1,4-diazepan-1-yl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine |
| SMILES | Cc1nc(N2CCCN(C)CC2)c2c3c(sc2n1)CC(C)CC3 |
| InChI | InChI=1S/C18H26N4S/c1-12-5-6-14-15(11-12)23-18-16(14)17(19-13(2)20-18)22-8-4-7-21(3)9-10-22/h12H,4-11H2,1-3H3 |
| InChIKey | WRGUQRQGJDPLEC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |