C18H23NOS — CID 42916666
N-benzyl-N-butan-2-yl-3-thiophen-2-ylpropanamide (PubChem CID 42916666) has the molecular formula C18H23NOS and a molecular weight of 301.45 g/mol. Its IUPAC name is N-benzyl-N-butan-2-yl-3-thiophen-2-ylpropanamide.
| Compound Name | N-benzyl-N-butan-2-yl-3-thiophen-2-ylpropanamide |
|---|---|
| PubChem CID | 42916666 |
| Molecular Formula | C18H23NOS |
| Molecular Weight | 301.45 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | N-benzyl-N-butan-2-yl-3-thiophen-2-ylpropanamide |
| SMILES | CCC(C)N(Cc1ccccc1)C(=O)CCc1cccs1 |
| InChI | InChI=1S/C18H23NOS/c1-3-15(2)19(14-16-8-5-4-6-9-16)18(20)12-11-17-10-7-13-21-17/h4-10,13,15H,3,11-12,14H2,1-2H3 |
| InChIKey | XHSFNAHXGXDXDX-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.45 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |