C20H20ClN3O3S — CID 42917725
2-(3-chlorophenoxy)-N-(2-morpholin-4-yl-1,3-benzothiazol-6-yl)propanamide (PubChem CID 42917725) has the molecular formula C20H20ClN3O3S and a molecular weight of 417.92 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)-N-(2-morpholin-4-yl-1,3-benzothiazol-6-yl)propanamide.
| Compound Name | 2-(3-chlorophenoxy)-N-(2-morpholin-4-yl-1,3-benzothiazol-6-yl)propanamide |
|---|---|
| PubChem CID | 42917725 |
| Molecular Formula | C20H20ClN3O3S |
| Molecular Weight | 417.92 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | 2-(3-chlorophenoxy)-N-(2-morpholin-4-yl-1,3-benzothiazol-6-yl)propanamide |
| SMILES | CC(Oc1cccc(Cl)c1)C(=O)Nc1ccc2nc(N3CCOCC3)sc2c1 |
| InChI | InChI=1S/C20H20ClN3O3S/c1-13(27-16-4-2-3-14(21)11-16)19(25)22-15-5-6-17-18(12-15)28-20(23-17)24-7-9-26-10-8-24/h2-6,11-13H,7-10H2,1H3,(H,22,25) |
| InChIKey | AEYWSDVFQFPTPX-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.92 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |