C18H20N2O6S2 — CID 42918457
[1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 4-(5-methylthiophen-2-yl)-4-oxobutanoate (PubChem CID 42918457) has the molecular formula C18H20N2O6S2 and a molecular weight of 424.50 g/mol. Its IUPAC name is [1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 4-(5-methylthiophen-2-yl)-4-oxobutanoate.
| Compound Name | [1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 4-(5-methylthiophen-2-yl)-4-oxobutanoate |
|---|---|
| PubChem CID | 42918457 |
| Molecular Formula | C18H20N2O6S2 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | [1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 4-(5-methylthiophen-2-yl)-4-oxobutanoate |
| SMILES | Cc1ccc(C(=O)CCC(=O)OC(C)C(=O)Nc2ccc(S(N)(=O)=O)cc2)s1 |
| InChI | InChI=1S/C18H20N2O6S2/c1-11-3-9-16(27-11)15(21)8-10-17(22)26-12(2)18(23)20-13-4-6-14(7-5-13)28(19,24)25/h3-7,9,12H,8,10H2,1-2H3,(H,20,23)(H2,19,24,25) |
| InChIKey | NXLIAYYEQXPQKV-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 132.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |